C8H10F2N2O5S2 — CID 43246875
4-(difluoromethylsulfonylamino)-2-methoxybenzenesulfonamide (PubChem CID 43246875) has the molecular formula C8H10F2N2O5S2 and a molecular weight of 316.31 g/mol. Its IUPAC name is 4-(difluoromethylsulfonylamino)-2-methoxybenzenesulfonamide.
| Compound Name | 4-(difluoromethylsulfonylamino)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 43246875 |
| Molecular Formula | C8H10F2N2O5S2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 4-(difluoromethylsulfonylamino)-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)C(F)F)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C8H10F2N2O5S2/c1-17-6-4-5(12-19(15,16)8(9)10)2-3-7(6)18(11,13)14/h2-4,8,12H,1H3,(H2,11,13,14) |
| InChIKey | GWEGXUWTNLAXEG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |