C10H16N2O3S — CID 141353715
4-(1-aminopropan-2-yl)-2-methoxybenzenesulfonamide (PubChem CID 141353715) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 4-(1-aminopropan-2-yl)-2-methoxybenzenesulfonamide.
| Compound Name | 4-(1-aminopropan-2-yl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 141353715 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 4-(1-aminopropan-2-yl)-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(C(C)CN)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C10H16N2O3S/c1-7(6-11)8-3-4-10(16(12,13)14)9(5-8)15-2/h3-5,7H,6,11H2,1-2H3,(H2,12,13,14) |
| InChIKey | FBHGVITVJDPRNA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |