C9H14N2O3S — CID 102704500
2-methoxy-4-(methylaminomethyl)benzenesulfonamide (PubChem CID 102704500) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-methoxy-4-(methylaminomethyl)benzenesulfonamide.
| Compound Name | 2-methoxy-4-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102704500 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-methoxy-4-(methylaminomethyl)benzenesulfonamide |
| SMILES | CNCc1ccc(S(N)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C9H14N2O3S/c1-11-6-7-3-4-9(15(10,12)13)8(5-7)14-2/h3-5,11H,6H2,1-2H3,(H2,10,12,13) |
| InChIKey | FBXYNSQFNICQHL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |