C10H13NO4S — CID 163498161
2-methoxy-4-(2-oxopropyl)benzenesulfonamide (PubChem CID 163498161) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-methoxy-4-(2-oxopropyl)benzenesulfonamide.
| Compound Name | 2-methoxy-4-(2-oxopropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 163498161 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-methoxy-4-(2-oxopropyl)benzenesulfonamide |
| SMILES | COc1cc(CC(C)=O)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C10H13NO4S/c1-7(12)5-8-3-4-10(16(11,13)14)9(6-8)15-2/h3-4,6H,5H2,1-2H3,(H2,11,13,14) |
| InChIKey | JRXKAHYZJKWRLH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |