C13H20N2O4S — CID 62677873
N-(3-methoxy-4-sulfamoylphenyl)-2,2-dimethylbutanamide (PubChem CID 62677873) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-(3-methoxy-4-sulfamoylphenyl)-2,2-dimethylbutanamide.
| Compound Name | N-(3-methoxy-4-sulfamoylphenyl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 62677873 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(3-methoxy-4-sulfamoylphenyl)-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1ccc(S(N)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C13H20N2O4S/c1-5-13(2,3)12(16)15-9-6-7-11(20(14,17)18)10(8-9)19-4/h6-8H,5H2,1-4H3,(H,15,16)(H2,14,17,18) |
| InChIKey | IXGCIOKGZXFCCA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |