C19H32N2O7S — CID 20793594
N-[4-[3-(ethoxymethoxy)propoxymethoxy]-3-sulfamoylphenyl]-2,2-dimethylbutanamide (PubChem CID 20793594) has the molecular formula C19H32N2O7S and a molecular weight of 432.54 g/mol. Its IUPAC name is N-[4-[3-(ethoxymethoxy)propoxymethoxy]-3-sulfamoylphenyl]-2,2-dimethylbutanamide.
| Compound Name | N-[4-[3-(ethoxymethoxy)propoxymethoxy]-3-sulfamoylphenyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 20793594 |
| Molecular Formula | C19H32N2O7S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N-[4-[3-(ethoxymethoxy)propoxymethoxy]-3-sulfamoylphenyl]-2,2-dimethylbutanamide |
| SMILES | CCOCOCCCOCOc1ccc(NC(=O)C(C)(C)CC)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H32N2O7S/c1-5-19(3,4)18(22)21-15-8-9-16(17(12-15)29(20,23)24)28-14-27-11-7-10-26-13-25-6-2/h8-9,12H,5-7,10-11,13-14H2,1-4H3,(H,21,22)(H2,20,23,24) |
| InChIKey | FPDGGSQCPOEILT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|