C11H16N2O6S2 — CID 61381356
N-(4-ethoxy-3-sulfamoylphenyl)-2-methylsulfonylacetamide (PubChem CID 61381356) has the molecular formula C11H16N2O6S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-(4-ethoxy-3-sulfamoylphenyl)-2-methylsulfonylacetamide.
| Compound Name | N-(4-ethoxy-3-sulfamoylphenyl)-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 61381356 |
| Molecular Formula | C11H16N2O6S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-(4-ethoxy-3-sulfamoylphenyl)-2-methylsulfonylacetamide |
| SMILES | CCOc1ccc(NC(=O)CS(C)(=O)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H16N2O6S2/c1-3-19-9-5-4-8(6-10(9)21(12,17)18)13-11(14)7-20(2,15)16/h4-6H,3,7H2,1-2H3,(H,13,14)(H2,12,17,18) |
| InChIKey | QGCPUVYCSUGPFN-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |