C17H27NO5 — CID 91169245
N-[4-(dihydroxymethyl)-3-(propan-2-yloxymethoxy)phenyl]-2,2-dimethylbutanamide (PubChem CID 91169245) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[4-(dihydroxymethyl)-3-(propan-2-yloxymethoxy)phenyl]-2,2-dimethylbutanamide.
| Compound Name | N-[4-(dihydroxymethyl)-3-(propan-2-yloxymethoxy)phenyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 91169245 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-[4-(dihydroxymethyl)-3-(propan-2-yloxymethoxy)phenyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1ccc(C(O)O)c(OCOC(C)C)c1 |
| InChI | InChI=1S/C17H27NO5/c1-6-17(4,5)16(21)18-12-7-8-13(15(19)20)14(9-12)23-10-22-11(2)3/h7-9,11,15,19-20H,6,10H2,1-5H3,(H,18,21) |
| InChIKey | JKOSEBBILXATEB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|