C7H8F2N2O4S2 — CID 61132086
2-(difluoromethylsulfonylamino)benzenesulfonamide (PubChem CID 61132086) has the molecular formula C7H8F2N2O4S2 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-(difluoromethylsulfonylamino)benzenesulfonamide.
| Compound Name | 2-(difluoromethylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 61132086 |
| Molecular Formula | C7H8F2N2O4S2 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 2-(difluoromethylsulfonylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H8F2N2O4S2/c8-7(9)17(14,15)11-5-3-1-2-4-6(5)16(10,12)13/h1-4,7,11H,(H2,10,12,13) |
| InChIKey | DNEDXRABZSJYEM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |