C8H8ClF2NO2S — CID 65030893
N-[2-(chloromethyl)phenyl]-1,1-difluoromethanesulfonamide (PubChem CID 65030893) has the molecular formula C8H8ClF2NO2S and a molecular weight of 255.67 g/mol. Its IUPAC name is N-[2-(chloromethyl)phenyl]-1,1-difluoromethanesulfonamide.
| Compound Name | N-[2-(chloromethyl)phenyl]-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 65030893 |
| Molecular Formula | C8H8ClF2NO2S |
| Molecular Weight | 255.67 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | N-[2-(chloromethyl)phenyl]-1,1-difluoromethanesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1CCl)C(F)F |
| InChI | InChI=1S/C8H8ClF2NO2S/c9-5-6-3-1-2-4-7(6)12-15(13,14)8(10)11/h1-4,8,12H,5H2 |
| InChIKey | MDITYTAAJWGJRC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.67 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|