C9H9F2NO5S — CID 63745528
2-[2-(difluoromethylsulfonylamino)phenoxy]acetic acid (PubChem CID 63745528) has the molecular formula C9H9F2NO5S and a molecular weight of 281.24 g/mol. Its IUPAC name is 2-[2-(difluoromethylsulfonylamino)phenoxy]acetic acid.
| Compound Name | 2-[2-(difluoromethylsulfonylamino)phenoxy]acetic acid |
|---|---|
| PubChem CID | 63745528 |
| Molecular Formula | C9H9F2NO5S |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 2-[2-(difluoromethylsulfonylamino)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C9H9F2NO5S/c10-9(11)18(15,16)12-6-3-1-2-4-7(6)17-5-8(13)14/h1-4,9,12H,5H2,(H,13,14) |
| InChIKey | QSZZNCVVIRPEJC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |