C10H12N2O7S — CID 114462681
2-[2-(methoxycarbonylsulfamoylamino)phenoxy]acetic acid (PubChem CID 114462681) has the molecular formula C10H12N2O7S and a molecular weight of 304.28 g/mol. Its IUPAC name is 2-[2-(methoxycarbonylsulfamoylamino)phenoxy]acetic acid.
| Compound Name | 2-[2-(methoxycarbonylsulfamoylamino)phenoxy]acetic acid |
|---|---|
| PubChem CID | 114462681 |
| Molecular Formula | C10H12N2O7S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-[2-(methoxycarbonylsulfamoylamino)phenoxy]acetic acid |
| SMILES | COC(=O)NS(=O)(=O)Nc1ccccc1OCC(=O)O |
| InChI | InChI=1S/C10H12N2O7S/c1-18-10(15)12-20(16,17)11-7-4-2-3-5-8(7)19-6-9(13)14/h2-5,11H,6H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | VMDBKOQPRMIFLZ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |