C15H13ClN2O5S — CID 110193413
methyl N-[(2-benzoyl-4-chlorophenyl)sulfamoyl]carbamate (PubChem CID 110193413) has the molecular formula C15H13ClN2O5S and a molecular weight of 368.80 g/mol. Its IUPAC name is methyl N-[(2-benzoyl-4-chlorophenyl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(2-benzoyl-4-chlorophenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 110193413 |
| Molecular Formula | C15H13ClN2O5S |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | methyl N-[(2-benzoyl-4-chlorophenyl)sulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)Nc1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H13ClN2O5S/c1-23-15(20)18-24(21,22)17-13-8-7-11(16)9-12(13)14(19)10-5-3-2-4-6-10/h2-9,17H,1H3,(H,18,20) |
| InChIKey | BSPNLQKNEYQXTH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|