C22H30ClN3O5S — CID 110193412
N,N-diethylpropan-1-amine;methyl N-[(2-benzoyl-4-chlorophenyl)sulfamoyl]carbamate (PubChem CID 110193412) has the molecular formula C22H30ClN3O5S and a molecular weight of 484.02 g/mol. Its IUPAC name is N,N-diethylpropan-1-amine;methyl N-[(2-benzoyl-4-chlorophenyl)sulfamoyl]carbamate.
| Compound Name | N,N-diethylpropan-1-amine;methyl N-[(2-benzoyl-4-chlorophenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 110193412 |
| Molecular Formula | C22H30ClN3O5S |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N,N-diethylpropan-1-amine;methyl N-[(2-benzoyl-4-chlorophenyl)sulfamoyl]carbamate |
| SMILES | CCCN(CC)CC.COC(=O)NS(=O)(=O)Nc1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H13ClN2O5S.C7H17N/c1-23-15(20)18-24(21,22)17-13-8-7-11(16)9-12(13)14(19)10-5-3-2-4-6-10;1-4-7-8(5-2)6-3/h2-9,17H,1H3,(H,18,20);4-7H2,1-3H3 |
| InChIKey | ZZYNXJCRRUPOJX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|