C10H12N2O6S — CID 115872550
methyl 2-(methoxycarbonylsulfamoylamino)benzoate (PubChem CID 115872550) has the molecular formula C10H12N2O6S and a molecular weight of 288.28 g/mol. Its IUPAC name is methyl 2-(methoxycarbonylsulfamoylamino)benzoate.
| Compound Name | methyl 2-(methoxycarbonylsulfamoylamino)benzoate |
|---|---|
| PubChem CID | 115872550 |
| Molecular Formula | C10H12N2O6S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | methyl 2-(methoxycarbonylsulfamoylamino)benzoate |
| SMILES | COC(=O)NS(=O)(=O)Nc1ccccc1C(=O)OC |
| InChI | InChI=1S/C10H12N2O6S/c1-17-9(13)7-5-3-4-6-8(7)11-19(15,16)12-10(14)18-2/h3-6,11H,1-2H3,(H,12,14) |
| InChIKey | KNFNZJMKAJPVOW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |