C15H17N5O7S — CID 13456603
methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoylamino]benzoate (PubChem CID 13456603) has the molecular formula C15H17N5O7S and a molecular weight of 411.40 g/mol. Its IUPAC name is methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoylamino]benzoate.
| Compound Name | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoylamino]benzoate |
|---|---|
| PubChem CID | 13456603 |
| Molecular Formula | C15H17N5O7S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NS(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C15H17N5O7S/c1-25-11-8-12(26-2)17-14(16-11)18-15(22)20-28(23,24)19-10-7-5-4-6-9(10)13(21)27-3/h4-8,19H,1-3H3,(H2,16,17,18,20,22) |
| InChIKey | UYRLDEWTOHIDSX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |