C15H18N4O7S2 — CID 154343693
1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethylsulfonylphenyl)sulfonylurea (PubChem CID 154343693) has the molecular formula C15H18N4O7S2 and a molecular weight of 430.46 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethylsulfonylphenyl)sulfonylurea.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethylsulfonylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 154343693 |
| Molecular Formula | C15H18N4O7S2 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethylsulfonylphenyl)sulfonylurea |
| SMILES | CCS(=O)(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C15H18N4O7S2/c1-4-27(21,22)10-7-5-6-8-11(10)28(23,24)19-15(20)18-14-16-12(25-2)9-13(17-14)26-3/h5-9H,4H2,1-3H3,(H2,16,17,18,19,20) |
| InChIKey | PQBRJWWIIILFJO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |