C16H15N5O7S — CID 70416029
3-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]indole-1-carboxylic acid (PubChem CID 70416029) has the molecular formula C16H15N5O7S and a molecular weight of 421.39 g/mol. Its IUPAC name is 3-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]indole-1-carboxylic acid.
| Compound Name | 3-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 70416029 |
| Molecular Formula | C16H15N5O7S |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 3-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]indole-1-carboxylic acid |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2cn(C(=O)O)c3ccccc23)n1 |
| InChI | InChI=1S/C16H15N5O7S/c1-27-12-7-13(28-2)18-14(17-12)19-15(22)20-29(25,26)11-8-21(16(23)24)10-6-4-3-5-9(10)11/h3-8H,1-2H3,(H,23,24)(H2,17,18,19,20,22) |
| InChIKey | WYCHDADZWRAGOP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 161.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |