C13H14N4O5S — CID 14774716
1-(2-hydroxyphenyl)sulfonyl-3-(4-methoxy-6-methylpyrimidin-2-yl)urea (PubChem CID 14774716) has the molecular formula C13H14N4O5S and a molecular weight of 338.35 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)sulfonyl-3-(4-methoxy-6-methylpyrimidin-2-yl)urea.
| Compound Name | 1-(2-hydroxyphenyl)sulfonyl-3-(4-methoxy-6-methylpyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 14774716 |
| Molecular Formula | C13H14N4O5S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-(2-hydroxyphenyl)sulfonyl-3-(4-methoxy-6-methylpyrimidin-2-yl)urea |
| SMILES | COc1cc(C)nc(NC(=O)NS(=O)(=O)c2ccccc2O)n1 |
| InChI | InChI=1S/C13H14N4O5S/c1-8-7-11(22-2)15-12(14-8)16-13(19)17-23(20,21)10-6-4-3-5-9(10)18/h3-7,18H,1-2H3,(H2,14,15,16,17,19) |
| InChIKey | HBQMQJRJESEJQR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |