C16H16N4O5S — CID 13472956
1-(4-methoxy-6-methylpyrimidin-2-yl)-3-(2-prop-2-ynoxyphenyl)sulfonylurea (PubChem CID 13472956) has the molecular formula C16H16N4O5S and a molecular weight of 376.39 g/mol. Its IUPAC name is 1-(4-methoxy-6-methylpyrimidin-2-yl)-3-(2-prop-2-ynoxyphenyl)sulfonylurea.
| Compound Name | 1-(4-methoxy-6-methylpyrimidin-2-yl)-3-(2-prop-2-ynoxyphenyl)sulfonylurea |
|---|---|
| PubChem CID | 13472956 |
| Molecular Formula | C16H16N4O5S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1-(4-methoxy-6-methylpyrimidin-2-yl)-3-(2-prop-2-ynoxyphenyl)sulfonylurea |
| SMILES | C#CCOc1ccccc1S(=O)(=O)NC(=O)Nc1nc(C)cc(OC)n1 |
| InChI | InChI=1S/C16H16N4O5S/c1-4-9-25-12-7-5-6-8-13(12)26(22,23)20-16(21)19-15-17-11(2)10-14(18-15)24-3/h1,5-8,10H,9H2,2-3H3,(H2,17,18,19,20,21) |
| InChIKey | BMTPWFPXOAARRQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|