C17H17F3N6O5S — CID 23039271
1-[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]-3-(2-prop-2-ynoxyphenyl)sulfonylurea (PubChem CID 23039271) has the molecular formula C17H17F3N6O5S and a molecular weight of 474.42 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]-3-(2-prop-2-ynoxyphenyl)sulfonylurea.
| Compound Name | 1-[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]-3-(2-prop-2-ynoxyphenyl)sulfonylurea |
|---|---|
| PubChem CID | 23039271 |
| Molecular Formula | C17H17F3N6O5S |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 1-[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]-3-(2-prop-2-ynoxyphenyl)sulfonylurea |
| SMILES | C#CCOc1ccccc1S(=O)(=O)NC(=O)Nc1nc(OCC(F)(F)F)nc(N(C)C)n1 |
| InChI | InChI=1S/C17H17F3N6O5S/c1-4-9-30-11-7-5-6-8-12(11)32(28,29)25-15(27)22-13-21-14(26(2)3)24-16(23-13)31-10-17(18,19)20/h1,5-8H,9-10H2,2-3H3,(H2,21,22,23,24,25,27) |
| InChIKey | XGYCUVHDCFUPAH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|