C16H19N5O6S — CID 13321801
1-[2-[(E)-but-2-enoxy]phenyl]sulfonyl-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea (PubChem CID 13321801) has the molecular formula C16H19N5O6S and a molecular weight of 409.42 g/mol. Its IUPAC name is 1-[2-[(E)-but-2-enoxy]phenyl]sulfonyl-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea.
| Compound Name | 1-[2-[(E)-but-2-enoxy]phenyl]sulfonyl-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea |
|---|---|
| PubChem CID | 13321801 |
| Molecular Formula | C16H19N5O6S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 1-[2-[(E)-but-2-enoxy]phenyl]sulfonyl-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea |
| SMILES | C/C=C/COc1ccccc1S(=O)(=O)NC(=O)Nc1nc(OC)nc(OC)n1 |
| InChI | InChI=1S/C16H19N5O6S/c1-4-5-10-27-11-8-6-7-9-12(11)28(23,24)21-14(22)17-13-18-15(25-2)20-16(19-13)26-3/h4-9H,10H2,1-3H3,(H2,17,18,19,20,21,22)/b5-4+ |
| InChIKey | YKHNAWWMJUREDH-SNAWJCMRSA-N |
| XLogP | 1.35 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|