C16H19N5O4S — CID 70456862
1-[(2-but-2-enoxy-3-pyridinyl)sulfonyl]-3-(4,6-dimethylpyrimidin-2-yl)urea (PubChem CID 70456862) has the molecular formula C16H19N5O4S and a molecular weight of 377.43 g/mol. Its IUPAC name is 1-[(2-but-2-enoxy-3-pyridinyl)sulfonyl]-3-(4,6-dimethylpyrimidin-2-yl)urea.
| Compound Name | 1-[(2-but-2-enoxy-3-pyridinyl)sulfonyl]-3-(4,6-dimethylpyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 70456862 |
| Molecular Formula | C16H19N5O4S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-[(2-but-2-enoxy-3-pyridinyl)sulfonyl]-3-(4,6-dimethylpyrimidin-2-yl)urea |
| SMILES | CC=CCOc1ncccc1S(=O)(=O)NC(=O)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C16H19N5O4S/c1-4-5-9-25-14-13(7-6-8-17-14)26(23,24)21-16(22)20-15-18-11(2)10-12(3)19-15/h4-8,10H,9H2,1-3H3,(H2,18,19,20,21,22) |
| InChIKey | QSVVBDCRJMQHCI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|