C9H15N5O3S — CID 13191141
1-(4,6-dimethylpyrimidin-2-yl)-3-(dimethylsulfamoyl)urea (PubChem CID 13191141) has the molecular formula C9H15N5O3S and a molecular weight of 273.32 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-3-(dimethylsulfamoyl)urea.
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-(dimethylsulfamoyl)urea |
|---|---|
| PubChem CID | 13191141 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-(dimethylsulfamoyl)urea |
| SMILES | Cc1cc(C)nc(NC(=O)NS(=O)(=O)N(C)C)n1 |
| InChI | InChI=1S/C9H15N5O3S/c1-6-5-7(2)11-8(10-6)12-9(15)13-18(16,17)14(3)4/h5H,1-4H3,(H2,10,11,12,13,15) |
| InChIKey | ZVQQRVAHTBYRGP-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |