C14H21N5O5S — CID 70417290
ethyl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoyl]-3-(methylamino)but-2-enoate (PubChem CID 70417290) has the molecular formula C14H21N5O5S and a molecular weight of 371.42 g/mol. Its IUPAC name is ethyl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoyl]-3-(methylamino)but-2-enoate.
| Compound Name | ethyl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoyl]-3-(methylamino)but-2-enoate |
|---|---|
| PubChem CID | 70417290 |
| Molecular Formula | C14H21N5O5S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | ethyl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoyl]-3-(methylamino)but-2-enoate |
| SMILES | CCOC(=O)C(=C(C)NC)S(=O)(=O)NC(=O)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C14H21N5O5S/c1-6-24-12(20)11(10(4)15-5)25(22,23)19-14(21)18-13-16-8(2)7-9(3)17-13/h7,15H,6H2,1-5H3,(H2,16,17,18,19,21) |
| InChIKey | CUQUJICGBGRWRP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|