C12H18N6O5S — CID 70490365
1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(methylamino)-4-oxopent-2-en-3-yl]sulfonylurea (PubChem CID 70490365) has the molecular formula C12H18N6O5S and a molecular weight of 358.38 g/mol. Its IUPAC name is 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(methylamino)-4-oxopent-2-en-3-yl]sulfonylurea.
| Compound Name | 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(methylamino)-4-oxopent-2-en-3-yl]sulfonylurea |
|---|---|
| PubChem CID | 70490365 |
| Molecular Formula | C12H18N6O5S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(methylamino)-4-oxopent-2-en-3-yl]sulfonylurea |
| SMILES | CNC(C)=C(C(C)=O)S(=O)(=O)NC(=O)Nc1nc(C)nc(OC)n1 |
| InChI | InChI=1S/C12H18N6O5S/c1-6(13-4)9(7(2)19)24(21,22)18-11(20)16-10-14-8(3)15-12(17-10)23-5/h13H,1-5H3,(H2,14,15,16,17,18,20) |
| InChIKey | VYBJSYDPVNSKOW-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 152.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|