C13H14N5O4SSe — CID 88679981
CID 88679981 (PubChem CID 88679981) has the molecular formula C13H14N5O4SSe and a molecular weight of 415.31 g/mol.
| Compound Name | CID 88679981 |
|---|---|
| PubChem CID | 88679981 |
| Molecular Formula | C13H14N5O4SSe |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | — |
| SMILES | COc1nc(C)nc(NC(=O)NS(=O)(=O)c2cccc([Se])c2C)n1 |
| InChI | InChI=1S/C13H14N5O4SSe/c1-7-9(5-4-6-10(7)24)23(20,21)18-12(19)16-11-14-8(2)15-13(17-11)22-3/h4-6H,1-3H3,(H2,14,15,16,17,18,19) |
| InChIKey | QKCJZVNIGJJZMZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|