C15H16IN5O6S — CID 21473150
ethyl 4-iodo-2-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate (PubChem CID 21473150) has the molecular formula C15H16IN5O6S and a molecular weight of 521.29 g/mol. Its IUPAC name is ethyl 4-iodo-2-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate.
| Compound Name | ethyl 4-iodo-2-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 21473150 |
| Molecular Formula | C15H16IN5O6S |
| Molecular Weight | 521.29 g/mol |
| Exact Mass | 520.99 |
| IUPAC Name | ethyl 4-iodo-2-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(I)cc1S(=O)(=O)NC(=O)Nc1nc(C)nc(OC)n1 |
| InChI | InChI=1S/C15H16IN5O6S/c1-4-27-12(22)10-6-5-9(16)7-11(10)28(24,25)21-14(23)19-13-17-8(2)18-15(20-13)26-3/h5-7H,4H2,1-3H3,(H2,17,18,19,20,21,23) |
| InChIKey | LUBKWVQUNFHSLH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|