C15H16IN5O6S — CID 162034413
4-ethyl-2-iodo-3-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoic acid (PubChem CID 162034413) has the molecular formula C15H16IN5O6S and a molecular weight of 521.29 g/mol. Its IUPAC name is 4-ethyl-2-iodo-3-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoic acid.
| Compound Name | 4-ethyl-2-iodo-3-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 162034413 |
| Molecular Formula | C15H16IN5O6S |
| Molecular Weight | 521.29 g/mol |
| Exact Mass | 520.99 |
| IUPAC Name | 4-ethyl-2-iodo-3-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoic acid |
| SMILES | CCc1ccc(C(=O)O)c(I)c1S(=O)(=O)NC(=O)Nc1nc(C)nc(OC)n1 |
| InChI | InChI=1S/C15H16IN5O6S/c1-4-8-5-6-9(12(22)23)10(16)11(8)28(25,26)21-14(24)19-13-17-7(2)18-15(20-13)27-3/h5-6H,4H2,1-3H3,(H,22,23)(H2,17,18,19,20,21,24) |
| InChIKey | YWLLKJVUTDVNRP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 160.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|