C6H10N6O4S — CID 13188538
1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-sulfamoylurea (PubChem CID 13188538) has the molecular formula C6H10N6O4S and a molecular weight of 262.25 g/mol. Its IUPAC name is 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-sulfamoylurea.
| Compound Name | 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-sulfamoylurea |
|---|---|
| PubChem CID | 13188538 |
| Molecular Formula | C6H10N6O4S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-sulfamoylurea |
| SMILES | COc1nc(C)nc(NC(=O)NS(N)(=O)=O)n1 |
| InChI | InChI=1S/C6H10N6O4S/c1-3-8-4(11-6(9-3)16-2)10-5(13)12-17(7,14)15/h1-2H3,(H2,7,14,15)(H2,8,9,10,11,12,13) |
| InChIKey | UBGCERUZIIBYEM-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 149.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |