C15H19N5O6S — CID 142801401
methyl (2Z,4Z,6E)-7-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]-5-methylhepta-2,4,6-trienoate (PubChem CID 142801401) has the molecular formula C15H19N5O6S and a molecular weight of 397.41 g/mol. Its IUPAC name is methyl (2Z,4Z,6E)-7-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]-5-methylhepta-2,4,6-trienoate.
| Compound Name | methyl (2Z,4Z,6E)-7-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]-5-methylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 142801401 |
| Molecular Formula | C15H19N5O6S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | methyl (2Z,4Z,6E)-7-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]-5-methylhepta-2,4,6-trienoate |
| SMILES | COC(=O)/C=C\C=C(C)/C=C/S(=O)(=O)NC(=O)Nc1nc(C)nc(OC)n1 |
| InChI | InChI=1S/C15H19N5O6S/c1-10(6-5-7-12(21)25-3)8-9-27(23,24)20-14(22)18-13-16-11(2)17-15(19-13)26-4/h5-9H,1-4H3,(H2,16,17,18,19,20,22)/b7-5-,9-8+,10-6- |
| InChIKey | ZBBLUPSLYYIMDD-CFHZKVOCSA-N |
| XLogP | 0.83 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|