C13H14N6O6S — CID 13282691
1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[(2-nitrophenyl)methylsulfonyl]urea (PubChem CID 13282691) has the molecular formula C13H14N6O6S and a molecular weight of 382.36 g/mol. Its IUPAC name is 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[(2-nitrophenyl)methylsulfonyl]urea.
| Compound Name | 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[(2-nitrophenyl)methylsulfonyl]urea |
|---|---|
| PubChem CID | 13282691 |
| Molecular Formula | C13H14N6O6S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[(2-nitrophenyl)methylsulfonyl]urea |
| SMILES | COc1nc(C)nc(NC(=O)NS(=O)(=O)Cc2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H14N6O6S/c1-8-14-11(17-13(15-8)25-2)16-12(20)18-26(23,24)7-9-5-3-4-6-10(9)19(21)22/h3-6H,7H2,1-2H3,(H2,14,15,16,17,18,20) |
| InChIKey | NYOVEYKGZYLOPT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 166.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|