C7H10N4O2 — CID 14076289
N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)acetamide (PubChem CID 14076289) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)acetamide.
| Compound Name | N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)acetamide |
|---|---|
| PubChem CID | 14076289 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)acetamide |
| SMILES | COc1nc(C)nc(NC(C)=O)n1 |
| InChI | InChI=1S/C7H10N4O2/c1-4-8-6(10-5(2)12)11-7(9-4)13-3/h1-3H3,(H,8,9,10,11,12) |
| InChIKey | GJXLCYBBQMEZRK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |