C12H12IN5O4S — CID 142784147
2-iodo-N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-sulfamoylbenzamide (PubChem CID 142784147) has the molecular formula C12H12IN5O4S and a molecular weight of 449.23 g/mol. Its IUPAC name is 2-iodo-N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-sulfamoylbenzamide.
| Compound Name | 2-iodo-N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 142784147 |
| Molecular Formula | C12H12IN5O4S |
| Molecular Weight | 449.23 g/mol |
| Exact Mass | 448.97 |
| IUPAC Name | 2-iodo-N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-sulfamoylbenzamide |
| SMILES | COc1nc(C)nc(NC(=O)c2cccc(S(N)(=O)=O)c2I)n1 |
| InChI | InChI=1S/C12H12IN5O4S/c1-6-15-11(18-12(16-6)22-2)17-10(19)7-4-3-5-8(9(7)13)23(14,20)21/h3-5H,1-2H3,(H2,14,20,21)(H,15,16,17,18,19) |
| InChIKey | UFCGFBFUJIYOBW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|