C22H23N7O9S2 — CID 67905489
methyl 2-[[[N'-(2-methoxycarbonylphenyl)sulfonyl-N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamimidoyl]amino]sulfamoyl]benzoate (PubChem CID 67905489) has the molecular formula C22H23N7O9S2 and a molecular weight of 593.60 g/mol. Its IUPAC name is methyl 2-[[[N'-(2-methoxycarbonylphenyl)sulfonyl-N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamimidoyl]amino]sulfamoyl]benzoate.
| Compound Name | methyl 2-[[[N'-(2-methoxycarbonylphenyl)sulfonyl-N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamimidoyl]amino]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 67905489 |
| Molecular Formula | C22H23N7O9S2 |
| Molecular Weight | 593.60 g/mol |
| Exact Mass | 593.10 |
| IUPAC Name | methyl 2-[[[N'-(2-methoxycarbonylphenyl)sulfonyl-N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamimidoyl]amino]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)N=C(NNS(=O)(=O)c1ccccc1C(=O)OC)Nc1nc(C)nc(OC)n1 |
| InChI | InChI=1S/C22H23N7O9S2/c1-13-23-20(26-22(24-13)38-4)25-21(28-39(32,33)16-11-7-5-9-14(16)18(30)36-2)27-29-40(34,35)17-12-8-6-10-15(17)19(31)37-3/h5-12,29H,1-4H3,(H2,23,24,25,26,27,28) |
| InChIKey | VRYHLQCWWKWGCN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 217.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.60 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|