C16H19N5O6S — CID 54341821
methyl 2-[[(methoxyamino)-[(4-methoxy-6-methylpyrimidin-2-yl)amino]methylidene]amino]sulfonylbenzoate (PubChem CID 54341821) has the molecular formula C16H19N5O6S and a molecular weight of 409.42 g/mol. Its IUPAC name is methyl 2-[[(methoxyamino)-[(4-methoxy-6-methylpyrimidin-2-yl)amino]methylidene]amino]sulfonylbenzoate.
| Compound Name | methyl 2-[[(methoxyamino)-[(4-methoxy-6-methylpyrimidin-2-yl)amino]methylidene]amino]sulfonylbenzoate |
|---|---|
| PubChem CID | 54341821 |
| Molecular Formula | C16H19N5O6S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | methyl 2-[[(methoxyamino)-[(4-methoxy-6-methylpyrimidin-2-yl)amino]methylidene]amino]sulfonylbenzoate |
| SMILES | CONC(=NS(=O)(=O)c1ccccc1C(=O)OC)Nc1nc(C)cc(OC)n1 |
| InChI | InChI=1S/C16H19N5O6S/c1-10-9-13(25-2)18-15(17-10)19-16(20-27-4)21-28(23,24)12-8-6-5-7-11(12)14(22)26-3/h5-9H,1-4H3,(H2,17,18,19,20,21) |
| InChIKey | TZMPBUHOWGFWET-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 141.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|