C14H14Cl2N4O4S — CID 13364616
1-[2-(dichloromethyl)phenyl]sulfonyl-3-(4-methoxy-6-methylpyrimidin-2-yl)urea (PubChem CID 13364616) has the molecular formula C14H14Cl2N4O4S and a molecular weight of 405.26 g/mol. Its IUPAC name is 1-[2-(dichloromethyl)phenyl]sulfonyl-3-(4-methoxy-6-methylpyrimidin-2-yl)urea.
| Compound Name | 1-[2-(dichloromethyl)phenyl]sulfonyl-3-(4-methoxy-6-methylpyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 13364616 |
| Molecular Formula | C14H14Cl2N4O4S |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 1-[2-(dichloromethyl)phenyl]sulfonyl-3-(4-methoxy-6-methylpyrimidin-2-yl)urea |
| SMILES | COc1cc(C)nc(NC(=O)NS(=O)(=O)c2ccccc2C(Cl)Cl)n1 |
| InChI | InChI=1S/C14H14Cl2N4O4S/c1-8-7-11(24-2)18-13(17-8)19-14(21)20-25(22,23)10-6-4-3-5-9(10)12(15)16/h3-7,12H,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | NJMJFZJOSHKJHD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|