C16H16N4O4S2 — CID 70449885
1-(4-methoxy-6-methylpyrimidin-2-yl)-3-(2H-thiochromen-8-ylsulfonyl)urea (PubChem CID 70449885) has the molecular formula C16H16N4O4S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-(4-methoxy-6-methylpyrimidin-2-yl)-3-(2H-thiochromen-8-ylsulfonyl)urea.
| Compound Name | 1-(4-methoxy-6-methylpyrimidin-2-yl)-3-(2H-thiochromen-8-ylsulfonyl)urea |
|---|---|
| PubChem CID | 70449885 |
| Molecular Formula | C16H16N4O4S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 1-(4-methoxy-6-methylpyrimidin-2-yl)-3-(2H-thiochromen-8-ylsulfonyl)urea |
| SMILES | COc1cc(C)nc(NC(=O)NS(=O)(=O)c2cccc3c2SCC=C3)n1 |
| InChI | InChI=1S/C16H16N4O4S2/c1-10-9-13(24-2)18-15(17-10)19-16(21)20-26(22,23)12-7-3-5-11-6-4-8-25-14(11)12/h3-7,9H,8H2,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | YAMLSFOLOSQARP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |