C13H10ClN4O6S- — CID 19418320
2-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]benzoate (PubChem CID 19418320) has the molecular formula C13H10ClN4O6S- and a molecular weight of 385.77 g/mol. Its IUPAC name is 2-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]benzoate.
| Compound Name | 2-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 19418320 |
| Molecular Formula | C13H10ClN4O6S- |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | 2-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]benzoate |
| SMILES | COc1cc(Cl)nc(NC(=O)NS(=O)(=O)c2ccccc2C(=O)[O-])n1 |
| InChI | InChI=1S/C13H11ClN4O6S/c1-24-10-6-9(14)15-12(16-10)17-13(21)18-25(22,23)8-5-3-2-4-7(8)11(19)20/h2-6H,1H3,(H,19,20)(H2,15,16,17,18,21)/p-1 |
| InChIKey | RIUXZHMCCFLRBI-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 150.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |