C15H15FN4O6S — CID 14721641
ethyl 2-[(4-fluoro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]benzoate (PubChem CID 14721641) has the molecular formula C15H15FN4O6S and a molecular weight of 398.37 g/mol. Its IUPAC name is ethyl 2-[(4-fluoro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]benzoate.
| Compound Name | ethyl 2-[(4-fluoro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 14721641 |
| Molecular Formula | C15H15FN4O6S |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | ethyl 2-[(4-fluoro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(F)cc(OC)n1 |
| InChI | InChI=1S/C15H15FN4O6S/c1-3-26-13(21)9-6-4-5-7-10(9)27(23,24)20-15(22)19-14-17-11(16)8-12(18-14)25-2/h4-8H,3H2,1-2H3,(H2,17,18,19,20,22) |
| InChIKey | HSKCVYGILOIDNN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |