C16H16ClFN4O6S — CID 54536768
ethyl 2-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]-3-(fluoromethyl)benzoate (PubChem CID 54536768) has the molecular formula C16H16ClFN4O6S and a molecular weight of 446.84 g/mol. Its IUPAC name is ethyl 2-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]-3-(fluoromethyl)benzoate.
| Compound Name | ethyl 2-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]-3-(fluoromethyl)benzoate |
|---|---|
| PubChem CID | 54536768 |
| Molecular Formula | C16H16ClFN4O6S |
| Molecular Weight | 446.84 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | ethyl 2-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]-3-(fluoromethyl)benzoate |
| SMILES | CCOC(=O)c1cccc(CF)c1S(=O)(=O)NC(=O)Nc1nc(Cl)cc(OC)n1 |
| InChI | InChI=1S/C16H16ClFN4O6S/c1-3-28-14(23)10-6-4-5-9(8-18)13(10)29(25,26)22-16(24)21-15-19-11(17)7-12(20-15)27-2/h4-7H,3,8H2,1-2H3,(H2,19,20,21,22,24) |
| InChIKey | ZAIDHYKXQDFAOB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |