C15H14ClN4O6S- — CID 162370964
N-(4-chloro-6-methoxypyrimidin-2-yl)-N'-(2-ethoxycarbonylphenyl)sulfonylcarbamimidate (PubChem CID 162370964) has the molecular formula C15H14ClN4O6S- and a molecular weight of 413.82 g/mol. Its IUPAC name is N-(4-chloro-6-methoxypyrimidin-2-yl)-N'-(2-ethoxycarbonylphenyl)sulfonylcarbamimidate.
| Compound Name | N-(4-chloro-6-methoxypyrimidin-2-yl)-N'-(2-ethoxycarbonylphenyl)sulfonylcarbamimidate |
|---|---|
| PubChem CID | 162370964 |
| Molecular Formula | C15H14ClN4O6S- |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | N-(4-chloro-6-methoxypyrimidin-2-yl)-N'-(2-ethoxycarbonylphenyl)sulfonylcarbamimidate |
| SMILES | CCOC(=O)c1ccccc1S(=O)(=O)/N=C(\[O-])Nc1nc(Cl)cc(OC)n1 |
| InChI | InChI=1S/C15H15ClN4O6S/c1-3-26-13(21)9-6-4-5-7-10(9)27(23,24)20-15(22)19-14-17-11(16)8-12(18-14)25-2/h4-8H,3H2,1-2H3,(H2,17,18,19,20,22)/p-1 |
| InChIKey | NSWAMPCUPHPTTC-UHFFFAOYSA-M |
| XLogP | 0.83 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|