C15H13ClIN4NaO7S — CID 155526522
sodium (4-chloro-6-methoxypyrimidin-2-yl)carbamoyl-[2-(2-iodoethoxycarbonyl)phenoxy]sulfonylazanide (PubChem CID 155526522) has the molecular formula C15H13ClIN4NaO7S and a molecular weight of 578.70 g/mol. Its IUPAC name is sodium (4-chloro-6-methoxypyrimidin-2-yl)carbamoyl-[2-(2-iodoethoxycarbonyl)phenoxy]sulfonylazanide.
| Compound Name | sodium (4-chloro-6-methoxypyrimidin-2-yl)carbamoyl-[2-(2-iodoethoxycarbonyl)phenoxy]sulfonylazanide |
|---|---|
| PubChem CID | 155526522 |
| Molecular Formula | C15H13ClIN4NaO7S |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 577.91 |
| IUPAC Name | sodium (4-chloro-6-methoxypyrimidin-2-yl)carbamoyl-[2-(2-iodoethoxycarbonyl)phenoxy]sulfonylazanide |
| SMILES | COc1cc(Cl)nc(NC(=O)[N-]S(=O)(=O)Oc2ccccc2C(=O)OCCI)n1.[Na+] |
| InChI | InChI=1S/C15H14ClIN4O7S.Na/c1-26-12-8-11(16)18-14(19-12)20-15(23)21-29(24,25)28-10-5-3-2-4-9(10)13(22)27-7-6-17;/h2-5,8H,6-7H2,1H3,(H2,18,19,20,21,23);/q;+1/p-1 |
| InChIKey | JSBZFABHKJROIO-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 147.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|