C18H19ClN4O6S — CID 174283635
2-[1-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylamino]prop-2-enylsulfonyl]ethyl benzoate (PubChem CID 174283635) has the molecular formula C18H19ClN4O6S and a molecular weight of 454.89 g/mol. Its IUPAC name is 2-[1-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylamino]prop-2-enylsulfonyl]ethyl benzoate.
| Compound Name | 2-[1-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylamino]prop-2-enylsulfonyl]ethyl benzoate |
|---|---|
| PubChem CID | 174283635 |
| Molecular Formula | C18H19ClN4O6S |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 2-[1-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylamino]prop-2-enylsulfonyl]ethyl benzoate |
| SMILES | C=CC(NC(=O)Nc1nc(Cl)cc(OC)n1)S(=O)(=O)CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19ClN4O6S/c1-3-15(22-18(25)23-17-20-13(19)11-14(21-17)28-2)30(26,27)10-9-29-16(24)12-7-5-4-6-8-12/h3-8,11,15H,1,9-10H2,2H3,(H2,20,21,22,23,25) |
| InChIKey | GRIMFVFXRKFMNV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|