C15H17N3O8S — CID 142770123
(2-ethoxyphenoxy)sulfonyl N-(4,6-dimethoxypyrimidin-2-yl)carbamate (PubChem CID 142770123) has the molecular formula C15H17N3O8S and a molecular weight of 399.38 g/mol. Its IUPAC name is (2-ethoxyphenoxy)sulfonyl N-(4,6-dimethoxypyrimidin-2-yl)carbamate.
| Compound Name | (2-ethoxyphenoxy)sulfonyl N-(4,6-dimethoxypyrimidin-2-yl)carbamate |
|---|---|
| PubChem CID | 142770123 |
| Molecular Formula | C15H17N3O8S |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | (2-ethoxyphenoxy)sulfonyl N-(4,6-dimethoxypyrimidin-2-yl)carbamate |
| SMILES | CCOc1ccccc1OS(=O)(=O)OC(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C15H17N3O8S/c1-4-24-10-7-5-6-8-11(10)25-27(20,21)26-15(19)18-14-16-12(22-2)9-13(17-14)23-3/h5-9H,4H2,1-3H3,(H,16,17,18,19) |
| InChIKey | YBZBHJVRDZRQBD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |