C14H14ClIN4O6S — CID 155547539
[2-(2-chloroethoxy)phenyl] N-[(4-iodo-6-methoxypyrimidin-2-yl)carbamoyl]sulfamate (PubChem CID 155547539) has the molecular formula C14H14ClIN4O6S and a molecular weight of 528.71 g/mol. Its IUPAC name is [2-(2-chloroethoxy)phenyl] N-[(4-iodo-6-methoxypyrimidin-2-yl)carbamoyl]sulfamate.
| Compound Name | [2-(2-chloroethoxy)phenyl] N-[(4-iodo-6-methoxypyrimidin-2-yl)carbamoyl]sulfamate |
|---|---|
| PubChem CID | 155547539 |
| Molecular Formula | C14H14ClIN4O6S |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 527.94 |
| IUPAC Name | [2-(2-chloroethoxy)phenyl] N-[(4-iodo-6-methoxypyrimidin-2-yl)carbamoyl]sulfamate |
| SMILES | COc1cc(I)nc(NC(=O)NS(=O)(=O)Oc2ccccc2OCCCl)n1 |
| InChI | InChI=1S/C14H14ClIN4O6S/c1-24-12-8-11(16)17-13(18-12)19-14(21)20-27(22,23)26-10-5-3-2-4-9(10)25-7-6-15/h2-5,8H,6-7H2,1H3,(H2,17,18,19,20,21) |
| InChIKey | JQZIKCBILMKPNP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|