C18H30N10O14S4 — CID 19607508
1-(4,6-dimethoxypyrimidin-2-yl)-3-[methyl(methylsulfonyl)sulfamoyl]urea (PubChem CID 19607508) has the molecular formula C18H30N10O14S4 and a molecular weight of 738.76 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-[methyl(methylsulfonyl)sulfamoyl]urea.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-[methyl(methylsulfonyl)sulfamoyl]urea |
|---|---|
| PubChem CID | 19607508 |
| Molecular Formula | C18H30N10O14S4 |
| Molecular Weight | 738.76 g/mol |
| Exact Mass | 738.08 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-[methyl(methylsulfonyl)sulfamoyl]urea |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)n1.COc1cc(OC)nc(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/2C9H15N5O7S2/c2*1-14(22(4,16)17)23(18,19)13-9(15)12-8-10-6(20-2)5-7(11-8)21-3/h2*5H,1-4H3,(H2,10,11,12,13,15) |
| InChIKey | NJVYFNFXWSLURE-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 313.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.76 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |