C21H24ClN7O10S2 — CID 70140389
2-chloro-6-nitro-3-phenoxyaniline;1-(4,6-dimethoxypyrimidin-2-yl)-3-[methyl(methylsulfonyl)sulfamoyl]urea (PubChem CID 70140389) has the molecular formula C21H24ClN7O10S2 and a molecular weight of 634.05 g/mol. Its IUPAC name is 2-chloro-6-nitro-3-phenoxyaniline;1-(4,6-dimethoxypyrimidin-2-yl)-3-[methyl(methylsulfonyl)sulfamoyl]urea.
| Compound Name | 2-chloro-6-nitro-3-phenoxyaniline;1-(4,6-dimethoxypyrimidin-2-yl)-3-[methyl(methylsulfonyl)sulfamoyl]urea |
|---|---|
| PubChem CID | 70140389 |
| Molecular Formula | C21H24ClN7O10S2 |
| Molecular Weight | 634.05 g/mol |
| Exact Mass | 633.07 |
| IUPAC Name | 2-chloro-6-nitro-3-phenoxyaniline;1-(4,6-dimethoxypyrimidin-2-yl)-3-[methyl(methylsulfonyl)sulfamoyl]urea |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)n1.Nc1c([N+](=O)[O-])ccc(Oc2ccccc2)c1Cl |
| InChI | InChI=1S/C12H9ClN2O3.C9H15N5O7S2/c13-11-10(18-8-4-2-1-3-5-8)7-6-9(12(11)14)15(16)17;1-14(22(4,16)17)23(18,19)13-9(15)12-8-10-6(20-2)5-7(11-8)21-3/h1-7H,14H2;5H,1-4H3,(H2,10,11,12,13,15) |
| InChIKey | VCWIKANHTPHDCC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 235.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.05 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|