C14H17ClN4O9S2 — CID 88686342
1-(5-chloro-2-hydroxyphenyl)sulfonyl-3-(4,6-dimethoxypyrimidin-2-yl)urea;methanesulfonic acid (PubChem CID 88686342) has the molecular formula C14H17ClN4O9S2 and a molecular weight of 484.90 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxyphenyl)sulfonyl-3-(4,6-dimethoxypyrimidin-2-yl)urea;methanesulfonic acid.
| Compound Name | 1-(5-chloro-2-hydroxyphenyl)sulfonyl-3-(4,6-dimethoxypyrimidin-2-yl)urea;methanesulfonic acid |
|---|---|
| PubChem CID | 88686342 |
| Molecular Formula | C14H17ClN4O9S2 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | 1-(5-chloro-2-hydroxyphenyl)sulfonyl-3-(4,6-dimethoxypyrimidin-2-yl)urea;methanesulfonic acid |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2cc(Cl)ccc2O)n1.CS(=O)(=O)O |
| InChI | InChI=1S/C13H13ClN4O6S.CH4O3S/c1-23-10-6-11(24-2)16-12(15-10)17-13(20)18-25(21,22)9-5-7(14)3-4-8(9)19;1-5(2,3)4/h3-6,19H,1-2H3,(H2,15,16,17,18,20);1H3,(H,2,3,4) |
| InChIKey | BGHOQPWCQRIGGI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 194.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|