C23H19Cl3F2N6O6S — CID 70135628
2-chloro-6-nitro-3-phenoxyaniline;N-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide (PubChem CID 70135628) has the molecular formula C23H19Cl3F2N6O6S and a molecular weight of 651.86 g/mol. Its IUPAC name is 2-chloro-6-nitro-3-phenoxyaniline;N-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide.
| Compound Name | 2-chloro-6-nitro-3-phenoxyaniline;N-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70135628 |
| Molecular Formula | C23H19Cl3F2N6O6S |
| Molecular Weight | 651.86 g/mol |
| Exact Mass | 650.01 |
| IUPAC Name | 2-chloro-6-nitro-3-phenoxyaniline;N-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide |
| SMILES | Cc1nn(-c2cc(NS(C)(=O)=O)c(Cl)cc2Cl)c(=O)n1C(F)F.Nc1c([N+](=O)[O-])ccc(Oc2ccccc2)c1Cl |
| InChI | InChI=1S/C12H9ClN2O3.C11H10Cl2F2N4O3S/c13-11-10(18-8-4-2-1-3-5-8)7-6-9(12(11)14)15(16)17;1-5-16-19(11(20)18(5)10(14)15)9-4-8(17-23(2,21)22)6(12)3-7(9)13/h1-7H,14H2;3-4,10,17H,1-2H3 |
| InChIKey | ZFRXRTLHSBLWTG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 164.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.86 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|